carvacrol
Identification (Source:EPA,EU)
| ID | 104 |
|---|---|
| Name | carvacrol |
| CAS | 499-75-2 |
| IUPAC | 5-isopropyl-2-methylphenol |
| Inchi | InChI=1S/C10H14O/c1-7(2)9-5-4-8(3)10(11)6-9/h4-7,11H,1-3H3 |
| CIPAC | |
| EPA Code | |
| Formula | C10H14O |
| SMILES | O([H])c(c(C([H])([H])[H])c([H])c([H])c1C([H])(C([H])([H])[H])C([H])([H])[H])c1[H] |
| Status | Not Available |
Classification
| Mode of Action | |
|---|---|
| Pesticide Type | |
| Chemical Group | |
| Classification |
botanical acaricides botanical insecticides botanical fungicides botanical nematicides |
Properties (Source:PubChem)
| Molecular Weight | 150.21755 |
|---|---|
| Physical State | |
| AlogP | 3.268 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 1 |
| Surface Area | 169.5 |
| Polar Surface Area | 20.23 |
Structure
ChemMapper Search Option (Docunmentation of ChemMapper)
Network initializing...Please wait
Node List
| ID | Name | Type |
|---|---|---|
Legend:
: Current entry node;
: Target node;
: Compound node;