butathiofos
Identification (Source:EPA,EU)
| ID | 1529 |
|---|---|
| Name | butathiofos |
| CAS | 90338-20-8 |
| IUPAC | |
| Inchi | InChI=1S/C12H21N2O3PS/c1-6-15-18(19,16-7-2)17-10-8-13-11(14-9-10)12(3,4)5/h8-9H,6-7H2,1-5H3 |
| CIPAC | |
| EPA Code | |
| Formula | C12H21N2O3PS |
| SMILES | S=P(OC([H])([H])C([H])([H])[H])(OC([H])([H])C([H])([H])[H])Oc(c([H])nc1C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H])c([H])n1 |
| Status | Not Available |
Classification
| Mode of Action | |
|---|---|
| Pesticide Type | |
| Chemical Group | |
| Classification |
heterocyclic organothiophosphate insecticides organothiophosphate insecticides pyrimidine organothiophosphate insecticides |
Properties (Source:PubChem)
| Molecular Weight | 304.3455 |
|---|---|
| Physical State | |
| AlogP | 2.731 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 6 |
| Surface Area | 316.52 |
| Polar Surface Area | 95.37 |
Structure
ChemMapper Search Option (Docunmentation of ChemMapper)
Network initializing...Please wait
Node List
| ID | Name | Type |
|---|---|---|
Legend:
: Current entry node;
: Target node;
: Compound node;