athidathion
Identification (Source:EPA,EU)
| ID | 1537 |
|---|---|
| Name | athidathion |
| CAS | 19691-80-6 |
| IUPAC | |
| Inchi | InChI=1S/C8H15N2O4PS3/c1-4-13-15(16,14-5-2)17-6-10-8(11)18-7(9-10)12-3/h4-6H2,1-3H3 |
| CIPAC | |
| EPA Code | |
| Formula | C8H15N2O4PS3 |
| SMILES | S(C([H])([H])N(C1=O)N=C(OC([H])([H])[H])S1)P(OC([H])([H])C([H])([H])[H])(OC([H])([H])C([H])([H])[H])=S |
| Status | Not Available |
Classification
| Mode of Action | |
|---|---|
| Pesticide Type | |
| Chemical Group | |
| Classification |
thiadiazole organothiophosphate insecticides heterocyclic organothiophosphate insecticides organothiophosphate insecticides |
Properties (Source:PubChem)
| Molecular Weight | 330.38446 |
|---|---|
| Physical State | |
| AlogP | 3.055 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 8 |
| Surface Area | 306.01 |
| Polar Surface Area | 152.86 |
Structure
ChemMapper Search Option (Docunmentation of ChemMapper)
Network initializing...Please wait
Node List
| ID | Name | Type |
|---|---|---|
Legend:
: Current entry node;
: Target node;
: Compound node;