| ID | 1000 |
|---|---|
| Name | pyroxasulfone |
| CAS | 447399-55-5 |
| IUPAC | |
| Inchi | InChI=1S/C12H14F5N3O4S/c1-11(2)4-7(19-24-11)25(21,22)5-6-8(12(15,16)17)18-20(3)9(6)23-10(13)14/h10H,4-5H2,1-3H3 |
| CIPAC | |
| EPA Code | |
| Formula | C12H14F5N3O4S |
| SMILES | c1(CS(C2=NOC(C)(C)C2)(=O)=O)c(C(F)(F)F)nn(c1OC(F)F)C |
| Status | Not Approved |
| Mode of Action | Sulfonylioxazoline ALS inhibitor, mode of action not fully understood. Good residual action. |
|---|---|
| Pesticide Type | Herbicide |
| Chemical Group | Pyrazole |
| Classification |
pyrazole herbicides oxazole herbicides |
| Molecular Weight | 391.32 |
|---|---|
| Physical State | |
| AlogP | 2.72 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 6 |
| Surface Area | 328.35 |
| Polar Surface Area | 91.16 |
Network initializing...Please wait
Node List
| ID | Name | Type |
|---|---|---|
Legend:
: Current entry node;
: Target node;
: Compound node;