demeton-methyl
Identification (Source:EPA,EU)
| ID | 209 |
|---|---|
| Name | demeton-methyl |
| CAS | 8022-00-2 |
| IUPAC | |
| Inchi | InChI=1S/C6H15O3PS2/c1-4-12-6-5-9-10(11,7-2)8-3/h4-6H2,1-3H3 |
| CIPAC | |
| EPA Code | |
| Formula | C6H15O3PS2 |
| SMILES | S(C([H])([H])C([H])([H])SC([H])([H])C([H])([H])[H])P(=O)(OC([H])([H])[H])OC([H])([H])[H].S(C([H])([H])C([H])([H])[H])C([H])([H])C([H])([H])OP(OC([H])([H])[H])(OC([H])([H])[H])=S |
| Status | Not Approved |
Classification
| Mode of Action | |
|---|---|
| Pesticide Type | |
| Chemical Group | |
| Classification |
organothiophosphate acaricides organothiophosphate insecticides aliphatic organothiophosphate insecticides |
Properties (Source:PubChem)
| Molecular Weight | 460.57052 |
|---|---|
| Physical State | |
| AlogP | 2.866 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 10 |
| Surface Area | 460.31 |
| Polar Surface Area | 190.82 |
Structure
ChemMapper Search Option (Docunmentation of ChemMapper)
Related targets
| Target Name | RScore (About this table) | |
|---|---|---|
| serum cholinesterase | 2(0,0,0,2) | Details |
Network initializing...Please wait
Node List
| ID | Name | Type |
|---|---|---|
Legend:
: Current entry node;
: Target node;
: Compound node;