triflusulfuron
Identification (Source:EPA,EU)
| ID | 1219 |
|---|---|
| Name | triflusulfuron |
| CAS | 135990-29-3 |
| IUPAC | |
| Inchi | InChI=1S/C16H17F3N6O6S/c1-8-5-4-6-9(11(26)27)10(8)32(29,30)24-14(28)21-12-20-13(25(2)3)23-15(22-12)31-7-16(17,18)19/h4-6H,7H2,1-3H3,(H,26,27)(H2,20,21,22,23,24,28) |
| CIPAC | 731 |
| EPA Code | |
| Formula | C16H17F3N6O6S |
| SMILES | OC(=O)c1cccc(C)c1S(=O)(=O)NC(=O)Nc1nc(N(C)C)nc(OCC(F)(F)F)n1 |
| Status | Approved |
Classification
| Mode of Action | Selective, inhibits amino acid sysnthesis |
|---|---|
| Pesticide Type | Herbicide |
| Chemical Group | Sulfonylurea |
| Classification |
triazinylsulfonylurea herbicides sulfonylurea herbicides |
Properties (Source:PubChem)
| Molecular Weight | 478.41 |
|---|---|
| Physical State | |
| AlogP | 2.425 |
| H-Bond Donor | 3 |
| H-Bond Acceptor | 10 |
| Surface Area | 429.82 |
| Polar Surface Area | 172.08 |
Structure
ChemMapper Search Option (Docunmentation of ChemMapper)
Network initializing...Please wait
Node List
| ID | Name | Type |
|---|---|---|
Legend:
: Current entry node;
: Target node;
: Compound node;