| ID | 1383 |
|---|---|
| Name | cyantraniliprole |
| CAS | 736994-63-1 |
| IUPAC | 3-bromo-1-(3-chloro-2-pyridyl)-4′-cyano-2′-methyl-6′-(methylcarbamoyl)pyrazole-5-carboxanilide |
| Inchi | InChI=1S/C19H14BrClN6O2/c1-10-6-11(9-22)7-12(18(28)23-2)16(10)25-19(29)14-8-15(20)26-27(14)17-13(21)4-3-5-24-17/h3-8H,1-2H3,(H,23,28)(H,25,29) |
| CIPAC | |
| EPA Code | |
| Formula | C19H14BrClN6O2 |
| SMILES | O=C(NC)c1cc(C#N)cc(c1NC(=O)c3cc(Br)nn3c2ncccc2Cl)C |
| Status | PENDING |
| Mode of Action | Exhibits larvicidal activity as an orally ingested toxicant by targeting and disrupting the Ca2+ balance, Second generation ryanodine receptor, Foliar and systemic activity |
|---|---|
| Pesticide Type | Insecticide |
| Chemical Group | Diamide |
| Classification |
diamide insecticides pyrazole insecticides |
| Molecular Weight | 473.71 |
|---|---|
| Physical State | |
| AlogP | 3.741 |
| H-Bond Donor | 2 |
| H-Bond Acceptor | 5 |
| Surface Area | 413.84 |
| Polar Surface Area | 112.69 |
Network initializing...Please wait
Node List
| ID | Name | Type |
|---|---|---|
Legend:
: Current entry node;
: Target node;
: Compound node;