2,3,5-tri-iodobenzoic acid
Identification (Source:EPA,EU)
| ID | 1688 |
|---|---|
| Name | 2,3,5-tri-iodobenzoic acid |
| CAS | 88-82-4 |
| IUPAC | 2,3,5-triiodobenzoic acid |
| Inchi | InChI=1S/C7H3I3O2/c8-3-1-4(7(11)12)6(10)5(9)2-3/h1-2H,(H,11,12) |
| CIPAC | |
| EPA Code | |
| Formula | C7H3I3O2 |
| SMILES | Ic1c(c([H])c(c([H])c1C(=O)O[H])I)I |
| Status | Not Available |
Classification
| Mode of Action | |
|---|---|
| Pesticide Type | |
| Chemical Group | |
| Classification |
growth inhibitors antiauxins |
Properties (Source:PubChem)
| Molecular Weight | 499.81092 |
|---|---|
| Physical State | |
| AlogP | 3.194 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 2 |
| Surface Area | 245.22 |
| Polar Surface Area | 37.29 |
Structure
ChemMapper Search Option (Docunmentation of ChemMapper)
Network initializing...Please wait
Node List
| ID | Name | Type |
|---|---|---|
Legend:
: Current entry node;
: Target node;
: Compound node;