sophamide
Identification (Source:EPA,EU)
| ID | 241 |
|---|---|
| Name | sophamide |
| CAS | 37032-15-8 |
| IUPAC | |
| Inchi | InChI=1S/C6H14NO4PS2/c1-9-5-7-6(8)4-14-12(13,10-2)11-3/h4-5H2,1-3H3,(H,7,8) |
| CIPAC | |
| EPA Code | |
| Formula | C6H14NO4PS2 |
| SMILES | S(C([H])([H])C(N([H])C([H])([H])OC([H])([H])[H])=O)P(OC([H])([H])[H])(OC([H])([H])[H])=S |
| Status | Not Available |
Classification
| Mode of Action | |
|---|---|
| Pesticide Type | |
| Chemical Group | |
| Classification |
aliphatic organothiophosphate insecticides organothiophosphate acaricides organothiophosphate insecticides aliphatic amide organothiophosphate insecticides |
Properties (Source:PubChem)
| Molecular Weight | 259.28342 |
|---|---|
| Physical State | |
| AlogP | 0.203 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 6 |
| Surface Area | 258.91 |
| Polar Surface Area | 123.99 |
Structure
ChemMapper Search Option (Docunmentation of ChemMapper)
Network initializing...Please wait
Node List
| ID | Name | Type |
|---|---|---|
Legend:
: Current entry node;
: Target node;
: Compound node;