penfluron
Identification (Source:EPA,EU)
| ID | 382 |
|---|---|
| Name | penfluron |
| CAS | 35367-31-8 |
| IUPAC | |
| Inchi | InChI=1S/C15H9F5N2O2/c16-10-2-1-3-11(17)12(10)13(23)22-14(24)21-9-6-4-8(5-7-9)15(18,19)20/h1-7H,(H2,21,22,23,24) |
| CIPAC | |
| EPA Code | |
| Formula | C15H9F5N2O2 |
| SMILES | FC(c(c([H])c([H])c1N([H])C(N([H])C(c2c(c([H])c([H])c([H])c2F)F)=O)=O)c([H])c1[H])(F)F |
| Status | Not Available |
Classification
| Mode of Action | |
|---|---|
| Pesticide Type | |
| Chemical Group | |
| Classification |
chitin synthesis inhibitors benzoylphenylurea chitin synthesis inhibitors Chemosterilants |
Properties (Source:PubChem)
| Molecular Weight | 344.23617 |
|---|---|
| Physical State | |
| AlogP | 3.748 |
| H-Bond Donor | 2 |
| H-Bond Acceptor | 2 |
| Surface Area | 286.82 |
| Polar Surface Area | 58.2 |
Structure
ChemMapper Search Option (Docunmentation of ChemMapper)
Network initializing...Please wait
Node List
| ID | Name | Type |
|---|---|---|
Legend:
: Current entry node;
: Target node;
: Compound node;