isotianil
Identification (Source:EPA,EU)
| ID | 420 |
|---|---|
| Name | isotianil |
| CAS | 224049-04-1 |
| IUPAC | 3,4-dichloro-2′-cyano-1,2-thiazole-5-carboxanilide |
| Inchi | InChI=1S/C11H5Cl2N3OS/c12-8-9(18-16-10(8)13)11(17)15-7-4-2-1-3-6(7)5-14/h1-4H,(H,15,17) |
| CIPAC | |
| EPA Code | |
| Formula | C11H5Cl2N3OS |
| SMILES | c1(snc(c1Cl)Cl)C(=O)Nc1c(cccc1)C#N |
| Status | Not Approved |
Classification
| Mode of Action | Not known |
|---|---|
| Pesticide Type | Fungicide |
| Chemical Group | Thiazole |
| Classification |
thiazole fungicides anilide fungicides |
Properties (Source:PubChem)
| Molecular Weight | 298.15 |
|---|---|
| Physical State | |
| AlogP | 3.335 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 3 |
| Surface Area | 265.89 |
| Polar Surface Area | 94.02 |
Structure
ChemMapper Search Option (Docunmentation of ChemMapper)
Network initializing...Please wait
Node List
| ID | Name | Type |
|---|---|---|
Legend:
: Current entry node;
: Target node;
: Compound node;