amisulbrom
Identification (Source:EPA,EU)
| ID | 450 |
|---|---|
| Name | amisulbrom |
| CAS | 348635-87-0 |
| IUPAC | |
| Inchi | InChI=1S/C13H13BrFN5O4S2/c1-8-12(14)10-5-4-9(15)6-11(10)20(8)25(21,22)13-16-7-19(17-13)26(23,24)18(2)3/h4-7H,1-3H3 |
| CIPAC | 789 |
| EPA Code | |
| Formula | C13H13BrFN5O4S2 |
| SMILES | O=S(=O)(c1ncn(n1)S(=O)(=O)N(C)C)n3c2cc(F)ccc2c(Br)c3C |
| Status | PENDING |
Classification
| Mode of Action | Qil (Quinone Inside Inhibitor) action. Respiration inhibitor. |
|---|---|
| Pesticide Type | Fungicide |
| Chemical Group | Sulfonamide |
| Classification |
sulfonamide fungicides triazole fungicides |
Properties (Source:PubChem)
| Molecular Weight | 466.31 |
|---|---|
| Physical State | |
| AlogP | 2.232 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 6 |
| Surface Area | 368.88 |
| Polar Surface Area | 123.92 |
Structure
ChemMapper Search Option (Docunmentation of ChemMapper)
Network initializing...Please wait
Node List
| ID | Name | Type |
|---|---|---|
Legend:
: Current entry node;
: Target node;
: Compound node;