pyraoxystrobin
Identification (Source:EPA,EU)
| ID | 475 |
|---|---|
| Name | pyraoxystrobin |
| CAS | 862588-11-2 |
| IUPAC | |
| Inchi | InChI=1S/C22H21ClN2O4/c1-25-21(12-20(24-25)15-8-10-17(23)11-9-15)29-13-16-6-4-5-7-18(16)19(14-27-2)22(26)28-3/h4-12,14H,13H2,1-3H3/b19-14+ |
| CIPAC | |
| EPA Code | |
| Formula | C22H21ClN2O4 |
| SMILES | Cn1c(cc(n1)c2ccc(cc2)Cl)OCc3ccccc3C(=COC)C(=O)OC |
| Status | Not Available |
Classification
| Mode of Action | Not known |
|---|---|
| Pesticide Type | Fungicide |
| Chemical Group | Pyrazole |
| Classification |
strobilurin fungicides pyrazole fungicides |
Properties (Source:PubChem)
| Molecular Weight | 412.87 |
|---|---|
| Physical State | |
| AlogP | 4.524 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 5 |
| Surface Area | 401.2 |
| Polar Surface Area | 62.58 |
Structure
ChemMapper Search Option (Docunmentation of ChemMapper)
Network initializing...Please wait
Node List
| ID | Name | Type |
|---|---|---|
Legend:
: Current entry node;
: Target node;
: Compound node;