sodium pentachlorophenoxide
Identification (Source:EPA,EU)
| ID | 486 |
|---|---|
| Name | sodium pentachlorophenoxide |
| CAS | 131-52-2 |
| IUPAC | |
| Inchi | InChI=1S/C6HCl5O.Na/c7-1-2(8)4(10)6(12)5(11)3(1)9;/h12H;/q;+1/p-1 |
| CIPAC | |
| EPA Code | |
| Formula | C6Cl5NaO |
| SMILES | Clc1c(c(c(c(c1[O-])Cl)Cl)Cl)Cl.[Na+] |
| Status | Not Available |
Classification
| Mode of Action | |
|---|---|
| Pesticide Type | |
| Chemical Group | |
| Classification |
Molluscicides aromatic fungicides |
Properties (Source:PubChem)
| Molecular Weight | 288.31836 |
|---|---|
| Physical State | |
| AlogP | 4.206 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 1 |
| Surface Area | 277.03 |
| Polar Surface Area | 83.88 |
Structure
ChemMapper Search Option (Docunmentation of ChemMapper)
Network initializing...Please wait
Node List
| ID | Name | Type |
|---|---|---|
Legend:
: Current entry node;
: Target node;
: Compound node;