| ID | 745 |
|---|---|
| Name | cyprosulfamide |
| CAS | 221667-31-8 |
| IUPAC | |
| Inchi | InChI=1S/C18H18N2O5S/c1-25-16-5-3-2-4-15(16)18(22)20-26(23,24)14-10-6-12(7-11-14)17(21)19-13-8-9-13/h2-7,10-11,13H,8-9H2,1H3,(H,19,21)(H,20,22) |
| CIPAC | 796 |
| EPA Code | |
| Formula | C18H18N2O5S |
| SMILES | O=C(c1ccc(cc1)S(=O)(=O)NC(=O)c2ccccc2OC)NC3CC3 |
| Status | Not Available |
| Mode of Action | Accelerates the herbicide detoxification process |
|---|---|
| Pesticide Type | Herbicide safener, Plant growth regulator |
| Chemical Group | Unclassified |
| Classification |
unclassified plant growth regulators Herbicide safeners |
| Molecular Weight | 374.41 |
|---|---|
| Physical State | |
| AlogP | 1.87 |
| H-Bond Donor | 2 |
| H-Bond Acceptor | 5 |
| Surface Area | 335.82 |
| Polar Surface Area | 109.95 |
Network initializing...Please wait
Node List
| ID | Name | Type |
|---|---|---|
Legend:
: Current entry node;
: Target node;
: Compound node;