flupoxam
Identification (Source:EPA,EU)
| ID | 777 |
|---|---|
| Name | flupoxam |
| CAS | 119126-15-7 |
| IUPAC | |
| Inchi | InChI=1S/C19H14ClF5N4O2/c20-14-7-6-13(8-12(14)9-31-10-18(21,22)19(23,24)25)29-17(11-4-2-1-3-5-11)27-16(28-29)15(26)30/h1-8H,9-10H2,(H2,26,30) |
| CIPAC | 8158 |
| EPA Code | |
| Formula | C19H14ClF5N4O2 |
| SMILES | n1c(C(=O)N)nc(c2ccccc2)n1c1cc(COCC(F)(F)C(F)(F)F)c(Cl)cc1 |
| Status | Not Approved |
Classification
| Mode of Action | Cell division inhibitor |
|---|---|
| Pesticide Type | Herbicide |
| Chemical Group | Triazine |
| Classification |
amide herbicides triazole herbicides |
Properties (Source:PubChem)
| Molecular Weight | 460.79 |
|---|---|
| Physical State | |
| AlogP | 4.368 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 4 |
| Surface Area | 395.26 |
| Polar Surface Area | 83.03 |
Structure
ChemMapper Search Option (Docunmentation of ChemMapper)
Network initializing...Please wait
Node List
| ID | Name | Type |
|---|---|---|
Legend:
: Current entry node;
: Target node;
: Compound node;