ipfencarbazone
Identification (Source:EPA,EU)
| ID | 799 |
|---|---|
| Name | ipfencarbazone |
| CAS | 212201-70-2 |
| IUPAC | |
| Inchi | InChI=1S/C18H14Cl2F2N4O2/c1-10(2)25(16-6-4-12(21)8-14(16)22)17(27)24-9-23-26(18(24)28)15-5-3-11(19)7-13(15)20/h3-10H,1-2H3 |
| CIPAC | |
| EPA Code | |
| Formula | C18H14Cl2F2N4O2 |
| SMILES | Fc1ccc(c(F)c1)N(C(C)C)C(=O)N3/C=N\N(c2ccc(Cl)cc2Cl)C3=O |
| Status | Not Available |
Classification
| Mode of Action | Not known |
|---|---|
| Pesticide Type | Herbicide |
| Chemical Group | Anilide |
| Classification |
anilide herbicides triazolone herbicides |
Properties (Source:PubChem)
| Molecular Weight | 427.23 |
|---|---|
| Physical State | |
| AlogP | 5.147 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 3 |
| Surface Area | 374.01 |
| Polar Surface Area | 56.22 |
Structure
ChemMapper Search Option (Docunmentation of ChemMapper)
Network initializing...Please wait
Node List
| ID | Name | Type |
|---|---|---|
Legend:
: Current entry node;
: Target node;
: Compound node;