| ID | 802 |
|---|---|
| Name | metamifop |
| CAS | 256412-89-2 |
| IUPAC | |
| Inchi | InChI=1S/C23H18ClFN2O4/c1-14(22(28)27(2)20-6-4-3-5-18(20)25)29-16-8-10-17(11-9-16)30-23-26-19-12-7-15(24)13-21(19)31-23/h3-14H,1-2H3/t14-/m1/s1 |
| CIPAC | |
| EPA Code | |
| Formula | C23H18ClFN2O4 |
| SMILES | c1c(N(C)C(=O)[C@H](Oc2ccc(cc2)Oc2nc3ccc(cc3o2)Cl)C)c(ccc1)F |
| Status | Not Approved |
| Mode of Action | ACCase inhibitor, causes chlorosis leading to growth retardation |
|---|---|
| Pesticide Type | Herbicide |
| Chemical Group | Aryloxyphenoxy propionate |
| Classification |
phenoxypropionic herbicides aryloxyphenoxypropionic herbicides anilide herbicides |
| Molecular Weight | 440.86 |
|---|---|
| Physical State | Beige coloured powder |
| AlogP | 5.637 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Surface Area | 401.23 |
| Polar Surface Area | 64.8 |
| Species | Method | Study Time | Dose Type | Value |
|---|---|---|---|---|
| Algae | Acute | 72 hour | EC50, growth | 2.03 mg l-1 |
| Aquatic invertebrates | Acute | 48 hour | EC50 | 0.288 mg l-1 |
| Earthworms | Acute | 14 day | LD50 | 1000 mg kg-1 |
| Fish | Acute | 96 hour | LC50 | 0.307 mg l-1 |
| Honeybees | Acute | 48 hour | LD50 | 100 μg bee-1 |
| Mammals | Acute oral | LD50 | > 2000 mg kg-1 |
Network initializing...Please wait
Node List
| ID | Name | Type |
|---|---|---|
Legend:
: Current entry node;
: Target node;
: Compound node;