pyrimisulfan
Identification (Source:EPA,EU)
| ID | 839 |
|---|---|
| Name | pyrimisulfan |
| CAS | 221205-90-9 |
| IUPAC | |
| Inchi | InChI=1S/C16H19F2N3O6S/c1-25-8-9-5-4-6-10(13(9)21-28(23,24)16(17)18)14(22)15-19-11(26-2)7-12(20-15)27-3/h4-7,14,16,21-22H,8H2,1-3H3 |
| CIPAC | |
| EPA Code | |
| Formula | C16H19F2N3O6S |
| SMILES | FC(F)S(Nc1c(cccc1COC)[C@@H](c1nc(OC)cc(n1)OC)O)(=O)=O |
| Status | Not Approved |
Classification
| Mode of Action | ALS inhibition |
|---|---|
| Pesticide Type | Herbicide |
| Chemical Group | Sulfonanilide |
| Classification |
anilide herbicides sulfonanilide herbicides |
Properties (Source:PubChem)
| Molecular Weight | 419.40 |
|---|---|
| Physical State | |
| AlogP | 1.636 |
| H-Bond Donor | 2 |
| H-Bond Acceptor | 8 |
| Surface Area | 386.29 |
| Polar Surface Area | 128.25 |
Structure
ChemMapper Search Option (Docunmentation of ChemMapper)
Network initializing...Please wait
Node List
| ID | Name | Type |
|---|---|---|
Legend:
: Current entry node;
: Target node;
: Compound node;