| ID | 845 |
|---|---|
| Name | bencarbazone |
| CAS | 173980-17-1 |
| IUPAC | |
| Inchi | InChI=1S/C13H13F4N5O3S2/c1-3-27(24,25)20-8-5-9(7(14)4-6(8)10(18)26)22-12(23)21(2)11(19-22)13(15,16)17/h4-5,20H,3H2,1-2H3,(H2,18,26) |
| CIPAC | |
| EPA Code | |
| Formula | C13H13F4N5O3S2 |
| SMILES | C(S(Nc1cc(c(cc1C(=S)N)F)n1nc(n(c1=O)C)C(F)(F)F)(=O)=O)C |
| Status | Not Available |
| Mode of Action | Protox inhibitor, absorbed by roots and foliage and translocated |
|---|---|
| Pesticide Type | Herbicide |
| Chemical Group | Triazalone |
| Classification |
thioamide herbicides triazolone herbicides |
| Molecular Weight | 427.40 |
|---|---|
| Physical State | |
| AlogP | 1.621 |
| H-Bond Donor | 2 |
| H-Bond Acceptor | 5 |
| Surface Area | 364.87 |
| Polar Surface Area | 148.57 |
Network initializing...Please wait
Node List
| ID | Name | Type |
|---|---|---|
Legend:
: Current entry node;
: Target node;
: Compound node;