| ID | 134 |
|---|---|
| Name | methiocarb |
| CAS | 2032-65-7 |
| IUPAC | 4-methylthio-3,5-xylyl methylcarbamate |
| Inchi | InChI=1S/C11H15NO2S/c1-7-5-9(14-11(13)12-3)6-8(2)10(7)15-4/h5-6H,1-4H3,(H,12,13) |
| CIPAC | 165 |
| EPA Code | 100501 |
| Formula | C11H15NO2S |
| SMILES | O=C(Oc1cc(c(SC)c(c1)C)C)NC |
| Status | Approved |
| Mode of Action | Non-systemic with neurotoxic contact and stomach action. Acetylcholinesterase (AChE) inhibitor. |
|---|---|
| Pesticide Type | Insecticide, Molluscicide |
| Chemical Group | Carbamate |
| Classification |
Molluscicides carbamate acaricides phenyl methylcarbamate insecticides Bird repellents |
| Molecular Weight | 225.31 |
|---|---|
| Physical State | Colourless crystals |
| AlogP | 3.107 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 3 |
| Surface Area | 236.69 |
| Polar Surface Area | 63.63 |
| Species | Method | Study Time | Dose Type | Value |
|---|---|---|---|---|
| Algae | Chronic | 96 hour | NOEC, growth | 3.2 mg l-1 |
| Algae | Acute | 72 hour | EC50, growth | 2.2 mg l-1 |
| Aquatic invertebrates | Chronic | 21 day | NOEC | 0.0001 mg l-1 |
| Aquatic invertebrates | Acute | 48 hour | EC50 | 0.008 mg l-1 |
| Birds | Short term dietary | LC50/LD50 | 1071 mg/kg feed | |
| Birds | Acute | LD50 | 5 mg kg-1 | |
| Earthworms | Acute | 14 day | LD50 | 1322 mg kg-1 |
| Earthworms | Chronic | 14 day | NOEC, reproduction | 0.32 mg kg-1 |
| Fish | Chronic | 21 day | NOEC | 0.05 mg l-1 |
| Fish | Acute | 96 hour | LC50 | 0.65 mg l-1 |
| Honeybees | Acute | 48 hour | LD50 | 0.23 μg bee-1 |
| Mammals | Acute oral | LD50 | 19 mg kg-1 | |
| Mammals | Short term dietary | NOEL | 10 ppm diet | |
| Mammals | Short term dietary | NOEL | 1.3 mg kg-1 | |
| Bio-concentration factor | CT50 | 1 days | ||
| Bio-concentration factor | BCF | 75 |
| Target Name | RScore (About this table) | |
|---|---|---|
| Acetylcholinesterase | 334(4,4,5,9) | Details |
| anticholinesterase | 95(1,1,2,10) | Details |
| estrogen receptor alpha | 87(0,2,5,12) | Details |
| cytochrome P450 (protein family or complex) | 46(0,1,2,11) | Details |
| FMO1 | 14(0,0,2,4) | Details |
Network initializing...Please wait
Node List
| ID | Name | Type |
|---|---|---|
Legend:
: Current entry node;
: Target node;
: Compound node;